C13H5F10NaO2 — CID 23708704
sodium (Z)-4,4,5,5,6,6,6-heptafluoro-3-oxo-1-[3-(trifluoromethyl)phenyl]hex-1-en-1-olate (PubChem CID 23708704) has the molecular formula C13H5F10NaO2 and a molecular weight of 406.15 g/mol. Its IUPAC name is sodium (Z)-4,4,5,5,6,6,6-heptafluoro-3-oxo-1-[3-(trifluoromethyl)phenyl]hex-1-en-1-olate.
| Compound Name | sodium (Z)-4,4,5,5,6,6,6-heptafluoro-3-oxo-1-[3-(trifluoromethyl)phenyl]hex-1-en-1-olate |
|---|---|
| PubChem CID | 23708704 |
| Molecular Formula | C13H5F10NaO2 |
| Molecular Weight | 406.15 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | sodium (Z)-4,4,5,5,6,6,6-heptafluoro-3-oxo-1-[3-(trifluoromethyl)phenyl]hex-1-en-1-olate |
| SMILES | O=C(/C=C(\[O-])c1cccc(C(F)(F)F)c1)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C13H6F10O2.Na/c14-10(15,12(19,20)13(21,22)23)9(25)5-8(24)6-2-1-3-7(4-6)11(16,17)18;/h1-5,24H;/q;+1/p-1/b8-5-; |
| InChIKey | LCXXLYCUDHNKLJ-HGKIGUAWSA-M |
| XLogP | 0.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|