About potassium 6-methylpyridin-3-olate
potassium 6-methylpyridin-3-olate (PubChem CID 23709082) has the molecular formula C6H6KNO
and a molecular weight of 147.22 g/mol. Its IUPAC name is potassium 6-methylpyridin-3-olate.
Molecular Properties
| Compound Name | potassium 6-methylpyridin-3-olate |
| PubChem CID | 23709082 |
| Molecular Formula | C6H6KNO |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.01 |
| IUPAC Name | potassium 6-methylpyridin-3-olate |
| SMILES | Cc1ccc([O-])cn1.[K+] |
| InChI | InChI=1S/C6H7NO.K/c1-5-2-3-6(8)4-7-5;/h2-4,8H,1H3;/q;+1/p-1 |
| InChIKey | MVWFZNQIEBKCFA-UHFFFAOYSA-M |
| XLogP | -2.53 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 6-methylpyridin-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 6-methylpyridin-3-olate?
The IUPAC name of potassium 6-methylpyridin-3-olate (CID 23709082) is potassium 6-methylpyridin-3-olate.
What is the SMILES notation for potassium 6-methylpyridin-3-olate?
The canonical SMILES for potassium 6-methylpyridin-3-olate is Cc1ccc([O-])cn1.[K+].
What is the InChIKey of potassium 6-methylpyridin-3-olate?
The InChIKey is MVWFZNQIEBKCFA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO.K/c1-5-2-3-6(8)4-7-5;/h2-4,8H,1H3;/q;+1/p-1.
What are the key properties of potassium 6-methylpyridin-3-olate?
potassium 6-methylpyridin-3-olate has a molecular weight of 147.22 g/mol, XLogP of -2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 6-methylpyridin-3-olate is sourced from PubChem (CID 23709082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).