About sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid
sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid (PubChem CID 23709621) has the molecular formula C23H16NNaO5
and a molecular weight of 409.37 g/mol. Its IUPAC name is sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid |
| PubChem CID | 23709621 |
| Molecular Formula | C23H16NNaO5 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2)nc2ccccc12.O=C([O-])c1ccccc1O.[Na+] |
| InChI | InChI=1S/C16H11NO2.C7H6O3.Na/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;8-6-4-2-1-3-5(6)7(9)10;/h1-10H,(H,18,19);1-4,8H,(H,9,10);/q;;+1/p-1 |
| InChIKey | CUFVINTYJGLAQV-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid?
The IUPAC name of sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid (CID 23709621) is sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid.
What is the SMILES notation for sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid?
The canonical SMILES for sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid is O=C(O)c1cc(-c2ccccc2)nc2ccccc12.O=C([O-])c1ccccc1O.[Na+].
What is the InChIKey of sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid?
The InChIKey is CUFVINTYJGLAQV-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H11NO2.C7H6O3.Na/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;8-6-4-2-1-3-5(6)7(9)10;/h1-10H,(H,18,19);1-4,8H,(H,9,10);/q;;+1/p-1.
What are the key properties of sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid?
sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid has a molecular weight of 409.37 g/mol, XLogP of 0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxybenzoate;2-phenylquinoline-4-carboxylic acid is sourced from PubChem (CID 23709621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).