About lithium;chlorate;trihydrate
lithium;chlorate;trihydrate (PubChem CID 23709801) has the molecular formula H6ClLiO6
and a molecular weight of 144.44 g/mol. Its IUPAC name is lithium;chlorate;trihydrate.
Molecular Properties
| Compound Name | lithium;chlorate;trihydrate |
| PubChem CID | 23709801 |
| Molecular Formula | H6ClLiO6 |
| Molecular Weight | 144.44 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | lithium;chlorate;trihydrate |
| SMILES | O.O.O.[Li+].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/ClO3.Li.3H2O/c2-1(3)4;;;;/h;;3*1H2/q-1;+1;;; |
| InChIKey | ZQHSGJCBRFDSEF-UHFFFAOYSA-N |
| XLogP | -9.04 |
| TPSA | 163.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.44 |
| LogP ≤ 5 | -9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;chlorate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;chlorate;trihydrate?
The IUPAC name of lithium;chlorate;trihydrate (CID 23709801) is lithium;chlorate;trihydrate.
What is the SMILES notation for lithium;chlorate;trihydrate?
The canonical SMILES for lithium;chlorate;trihydrate is O.O.O.[Li+].[O-][Cl+2]([O-])[O-].
What is the InChIKey of lithium;chlorate;trihydrate?
The InChIKey is ZQHSGJCBRFDSEF-UHFFFAOYSA-N. The full InChI is InChI=1S/ClO3.Li.3H2O/c2-1(3)4;;;;/h;;3*1H2/q-1;+1;;;.
What are the key properties of lithium;chlorate;trihydrate?
lithium;chlorate;trihydrate has a molecular weight of 144.44 g/mol, XLogP of -9.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;chlorate;trihydrate is sourced from PubChem (CID 23709801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).