C18H14Cl2KNO3 — CID 23711182
potassium 1,3-dichloro-8-ethyl-5,6,6a,11b-tetrahydro-[1]benzofuro[2,3-c]quinoline-6-carboxylate (PubChem CID 23711182) has the molecular formula C18H14Cl2KNO3 and a molecular weight of 402.32 g/mol. Its IUPAC name is potassium 1,3-dichloro-8-ethyl-5,6,6a,11b-tetrahydro-[1]benzofuro[2,3-c]quinoline-6-carboxylate.
| Compound Name | potassium 1,3-dichloro-8-ethyl-5,6,6a,11b-tetrahydro-[1]benzofuro[2,3-c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 23711182 |
| Molecular Formula | C18H14Cl2KNO3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | potassium 1,3-dichloro-8-ethyl-5,6,6a,11b-tetrahydro-[1]benzofuro[2,3-c]quinoline-6-carboxylate |
| SMILES | CCc1cccc2c1OC1C(C(=O)[O-])Nc3cc(Cl)cc(Cl)c3C21.[K+] |
| InChI | InChI=1S/C18H15Cl2NO3.K/c1-2-8-4-3-5-10-13-14-11(20)6-9(19)7-12(14)21-15(18(22)23)17(13)24-16(8)10;/h3-7,13,15,17,21H,2H2,1H3,(H,22,23);/q;+1/p-1 |
| InChIKey | OVYOGXCBOMJEPH-UHFFFAOYSA-M |
| XLogP | -0.00 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |