About potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate
potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate (PubChem CID 23712022) has the molecular formula C6H4F3KN2S2
and a molecular weight of 264.34 g/mol. Its IUPAC name is potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate.
Molecular Properties
| Compound Name | potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate |
| PubChem CID | 23712022 |
| Molecular Formula | C6H4F3KN2S2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate |
| SMILES | N#C/N=C(\[S-])SCCC(F)=C(F)F.[K+] |
| InChI | InChI=1S/C6H5F3N2S2.K/c7-4(5(8)9)1-2-13-6(12)11-3-10;/h1-2H2,(H,11,12);/q;+1/p-1 |
| InChIKey | HXNFOPXXYLOKMP-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate?
The IUPAC name of potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate (CID 23712022) is potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate.
What is the SMILES notation for potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate?
The canonical SMILES for potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate is N#C/N=C(\[S-])SCCC(F)=C(F)F.[K+].
What is the InChIKey of potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate?
The InChIKey is HXNFOPXXYLOKMP-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5F3N2S2.K/c7-4(5(8)9)1-2-13-6(12)11-3-10;/h1-2H2,(H,11,12);/q;+1/p-1.
What are the key properties of potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate?
potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate has a molecular weight of 264.34 g/mol, XLogP of -0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-cyano-1-(3,4,4-trifluorobut-3-enylsulfanyl)methanimidothioate is sourced from PubChem (CID 23712022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).