C24H25F2NaO4 — CID 23712445
sodium (E,3R,5S)-8-[bis(4-fluorophenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoate (PubChem CID 23712445) has the molecular formula C24H25F2NaO4 and a molecular weight of 438.45 g/mol. Its IUPAC name is sodium (E,3R,5S)-8-[bis(4-fluorophenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoate.
| Compound Name | sodium (E,3R,5S)-8-[bis(4-fluorophenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoate |
|---|---|
| PubChem CID | 23712445 |
| Molecular Formula | C24H25F2NaO4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | sodium (E,3R,5S)-8-[bis(4-fluorophenyl)methylidene]-3,5-dihydroxy-9-methyldec-6-enoate |
| SMILES | CC(C)C(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])=C(c1ccc(F)cc1)c1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C24H26F2O4.Na/c1-15(2)22(12-11-20(27)13-21(28)14-23(29)30)24(16-3-7-18(25)8-4-16)17-5-9-19(26)10-6-17;/h3-12,15,20-21,27-28H,13-14H2,1-2H3,(H,29,30);/q;+1/p-1/b12-11+;/t20-,21-;/m1./s1 |
| InChIKey | RYCBNNYZAJLRPD-JUGDMTMFSA-M |
| XLogP | 0.23 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|