C13H19N2NaO3 — CID 23713026
sodium 1,4-dimethyl-3-propan-2-yl-7-aza-9-azanidaspiro[4.5]decane-6,8,10-trione (PubChem CID 23713026) has the molecular formula C13H19N2NaO3 and a molecular weight of 274.30 g/mol. Its IUPAC name is sodium 1,4-dimethyl-3-propan-2-yl-7-aza-9-azanidaspiro[4.5]decane-6,8,10-trione.
| Compound Name | sodium 1,4-dimethyl-3-propan-2-yl-7-aza-9-azanidaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 23713026 |
| Molecular Formula | C13H19N2NaO3 |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | sodium 1,4-dimethyl-3-propan-2-yl-7-aza-9-azanidaspiro[4.5]decane-6,8,10-trione |
| SMILES | CC(C)C1CC(C)C2(C(=O)[N-]C(=O)NC2=O)C1C.[Na+] |
| InChI | InChI=1S/C13H20N2O3.Na/c1-6(2)9-5-7(3)13(8(9)4)10(16)14-12(18)15-11(13)17;/h6-9H,5H2,1-4H3,(H2,14,15,16,17,18);/q;+1/p-1 |
| InChIKey | SEAVSYIBHBJDCO-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|