sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione

C11H18NNaO3 — CID 23713051

IUPACsodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione
SMILESCC(C)CC1(CC(C)C)OC(=O)[N-]C1=O.[Na+]
InChIInChI=1S/C11H19NO3.Na/c1-7(2)5-11(6-8(3)4)9(13)12-10(14)15-11;/h7-8H,5-6H2,1-4H3,(H,12,13,14);/q;+1/p-1
InChIKeyZNVPBPUOWYFCHW-UHFFFAOYSA-M
MW235.26 g/mol
LogP-0.13
Rot. Bonds4

About sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione

sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione (PubChem CID 23713051) has the molecular formula C11H18NNaO3 and a molecular weight of 235.26 g/mol. Its IUPAC name is sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione.

Molecular Properties

Compound Namesodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione
PubChem CID23713051
Molecular FormulaC11H18NNaO3
Molecular Weight235.26 g/mol
Exact Mass235.12
IUPAC Namesodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione
SMILESCC(C)CC1(CC(C)C)OC(=O)[N-]C1=O.[Na+]
InChIInChI=1S/C11H19NO3.Na/c1-7(2)5-11(6-8(3)4)9(13)12-10(14)15-11;/h7-8H,5-6H2,1-4H3,(H,12,13,14);/q;+1/p-1
InChIKeyZNVPBPUOWYFCHW-UHFFFAOYSA-M
XLogP-0.13
TPSA57.47 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.26
LogP ≤ 5-0.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione?
The IUPAC name of sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione (CID 23713051) is sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione.
What is the SMILES notation for sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione?
The canonical SMILES for sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione is CC(C)CC1(CC(C)C)OC(=O)[N-]C1=O.[Na+].
What is the InChIKey of sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione?
The InChIKey is ZNVPBPUOWYFCHW-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H19NO3.Na/c1-7(2)5-11(6-8(3)4)9(13)12-10(14)15-11;/h7-8H,5-6H2,1-4H3,(H,12,13,14);/q;+1/p-1.
What are the key properties of sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione?
sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione has a molecular weight of 235.26 g/mol, XLogP of -0.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5,5-bis(2-methylpropyl)-1,3-oxazolidin-3-ide-2,4-dione is sourced from PubChem (CID 23713051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).