About sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate
sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 23713914) has the molecular formula C13H10NNaO4
and a molecular weight of 267.22 g/mol. Its IUPAC name is sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
Molecular Properties
| Compound Name | sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| PubChem CID | 23713914 |
| Molecular Formula | C13H10NNaO4 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | O=C(c1ccoc1)c1ccc2n1CCC2C(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H11NO4.Na/c15-12(8-4-6-18-7-8)11-2-1-10-9(13(16)17)3-5-14(10)11;/h1-2,4,6-7,9H,3,5H2,(H,16,17);/q;+1/p-1 |
| InChIKey | GSVXBWAZMYSUAR-UHFFFAOYSA-M |
| XLogP | -2.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The IUPAC name of sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (CID 23713914) is sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
What is the SMILES notation for sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The canonical SMILES for sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate is O=C(c1ccoc1)c1ccc2n1CCC2C(=O)[O-].[Na+].
What is the InChIKey of sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The InChIKey is GSVXBWAZMYSUAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H11NO4.Na/c15-12(8-4-6-18-7-8)11-2-1-10-9(13(16)17)3-5-14(10)11;/h1-2,4,6-7,9H,3,5H2,(H,16,17);/q;+1/p-1.
What are the key properties of sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate has a molecular weight of 267.22 g/mol, XLogP of -2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-(furan-3-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate is sourced from PubChem (CID 23713914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).