About potassium methyl-oxido-oxophosphanium
potassium methyl-oxido-oxophosphanium (PubChem CID 23714116) has the molecular formula CH3KO2P+
and a molecular weight of 117.10 g/mol. Its IUPAC name is potassium methyl-oxido-oxophosphanium.
Molecular Properties
| Compound Name | potassium methyl-oxido-oxophosphanium |
|---|
| PubChem CID | 23714116 |
|---|
| Molecular Formula | CH3KO2P+ |
|---|
| Molecular Weight | 117.10 g/mol |
|---|
| Exact Mass | 116.95 |
|---|
| IUPAC Name | potassium methyl-oxido-oxophosphanium |
|---|
| SMILES | C[P+](=O)[O-].[K+] |
|---|
| InChI | InChI=1S/CH3O2P.K/c1-4(2)3;/h1H3;/q;+1 |
|---|
| InChIKey | XTMJYPXUXCUFPM-UHFFFAOYSA-N |
|---|
| XLogP | -3.28 |
|---|
| TPSA | 40.13 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 5 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium methyl-oxido-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium methyl-oxido-oxophosphanium?
The IUPAC name of potassium methyl-oxido-oxophosphanium (CID 23714116) is potassium methyl-oxido-oxophosphanium.
What is the SMILES notation for potassium methyl-oxido-oxophosphanium?
The canonical SMILES for potassium methyl-oxido-oxophosphanium is C[P+](=O)[O-].[K+].
What is the InChIKey of potassium methyl-oxido-oxophosphanium?
The InChIKey is XTMJYPXUXCUFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3O2P.K/c1-4(2)3;/h1H3;/q;+1.
What are the key properties of potassium methyl-oxido-oxophosphanium?
potassium methyl-oxido-oxophosphanium has a molecular weight of 117.10 g/mol, XLogP of -3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium methyl-oxido-oxophosphanium is sourced from PubChem (CID 23714116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).