potassium (E)-3-oxobut-1-en-1-olate

C4H5KO2 — CID 23715725

IUPACpotassium (E)-3-oxobut-1-en-1-olate
SMILESCC(=O)/C=C/[O-].[K+]
InChIInChI=1S/C4H6O2.K/c1-4(6)2-3-5;/h2-3,5H,1H3;/q;+1/p-1/b3-2+;
InChIKeyTWLFHYXYMWHRGQ-SQQVDAMQSA-M
MW124.18 g/mol
LogP-3.55
Rot. Bonds1

About potassium (E)-3-oxobut-1-en-1-olate

potassium (E)-3-oxobut-1-en-1-olate (PubChem CID 23715725) has the molecular formula C4H5KO2 and a molecular weight of 124.18 g/mol. Its IUPAC name is potassium (E)-3-oxobut-1-en-1-olate.

Molecular Properties

Compound Namepotassium (E)-3-oxobut-1-en-1-olate
PubChem CID23715725
Molecular FormulaC4H5KO2
Molecular Weight124.18 g/mol
Exact Mass123.99
IUPAC Namepotassium (E)-3-oxobut-1-en-1-olate
SMILESCC(=O)/C=C/[O-].[K+]
InChIInChI=1S/C4H6O2.K/c1-4(6)2-3-5;/h2-3,5H,1H3;/q;+1/p-1/b3-2+;
InChIKeyTWLFHYXYMWHRGQ-SQQVDAMQSA-M
XLogP-3.55
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500124.18
LogP ≤ 5-3.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze potassium (E)-3-oxobut-1-en-1-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (E)-3-oxobut-1-en-1-olate?
The IUPAC name of potassium (E)-3-oxobut-1-en-1-olate (CID 23715725) is potassium (E)-3-oxobut-1-en-1-olate.
What is the SMILES notation for potassium (E)-3-oxobut-1-en-1-olate?
The canonical SMILES for potassium (E)-3-oxobut-1-en-1-olate is CC(=O)/C=C/[O-].[K+].
What is the InChIKey of potassium (E)-3-oxobut-1-en-1-olate?
The InChIKey is TWLFHYXYMWHRGQ-SQQVDAMQSA-M. The full InChI is InChI=1S/C4H6O2.K/c1-4(6)2-3-5;/h2-3,5H,1H3;/q;+1/p-1/b3-2+;.
What are the key properties of potassium (E)-3-oxobut-1-en-1-olate?
potassium (E)-3-oxobut-1-en-1-olate has a molecular weight of 124.18 g/mol, XLogP of -3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (E)-3-oxobut-1-en-1-olate is sourced from PubChem (CID 23715725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).