C11H17N2NaO3S — CID 23716033
sodium 5-(tert-butylsulfanylmethyl)-5-ethylpyrimidin-3-ide-2,4,6-trione (PubChem CID 23716033) has the molecular formula C11H17N2NaO3S and a molecular weight of 280.32 g/mol. Its IUPAC name is sodium 5-(tert-butylsulfanylmethyl)-5-ethylpyrimidin-3-ide-2,4,6-trione.
| Compound Name | sodium 5-(tert-butylsulfanylmethyl)-5-ethylpyrimidin-3-ide-2,4,6-trione |
|---|---|
| PubChem CID | 23716033 |
| Molecular Formula | C11H17N2NaO3S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | sodium 5-(tert-butylsulfanylmethyl)-5-ethylpyrimidin-3-ide-2,4,6-trione |
| SMILES | CCC1(CSC(C)(C)C)C(=O)[N-]C(=O)NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O3S.Na/c1-5-11(6-17-10(2,3)4)7(14)12-9(16)13-8(11)15;/h5-6H2,1-4H3,(H2,12,13,14,15,16);/q;+1/p-1 |
| InChIKey | BMUQNVDNKCRFOL-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|