About sodium 2-(decanoylamino)acetate
sodium 2-(decanoylamino)acetate (PubChem CID 23716190) has the molecular formula C12H22NNaO3
and a molecular weight of 251.30 g/mol. Its IUPAC name is sodium 2-(decanoylamino)acetate.
Molecular Properties
| Compound Name | sodium 2-(decanoylamino)acetate |
| PubChem CID | 23716190 |
| Molecular Formula | C12H22NNaO3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | sodium 2-(decanoylamino)acetate |
| SMILES | CCCCCCCCCC(=O)NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H23NO3.Na/c1-2-3-4-5-6-7-8-9-11(14)13-10-12(15)16;/h2-10H2,1H3,(H,13,14)(H,15,16);/q;+1/p-1 |
| InChIKey | PPGDKNYZDLSHTJ-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-(decanoylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(decanoylamino)acetate?
The IUPAC name of sodium 2-(decanoylamino)acetate (CID 23716190) is sodium 2-(decanoylamino)acetate.
What is the SMILES notation for sodium 2-(decanoylamino)acetate?
The canonical SMILES for sodium 2-(decanoylamino)acetate is CCCCCCCCCC(=O)NCC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-(decanoylamino)acetate?
The InChIKey is PPGDKNYZDLSHTJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23NO3.Na/c1-2-3-4-5-6-7-8-9-11(14)13-10-12(15)16;/h2-10H2,1H3,(H,13,14)(H,15,16);/q;+1/p-1.
What are the key properties of sodium 2-(decanoylamino)acetate?
sodium 2-(decanoylamino)acetate has a molecular weight of 251.30 g/mol, XLogP of -2.00, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(decanoylamino)acetate is sourced from PubChem (CID 23716190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).