C25H26N6NaO5PS — CID 23716304
sodium;2-butyl-6-methyl-3-[[4-[4-(2H-tetrazol-5-yl)thiophen-3-yl]phenyl]methyl]quinazolin-4-one;dihydrogen phosphate (PubChem CID 23716304) has the molecular formula C25H26N6NaO5PS and a molecular weight of 576.55 g/mol. Its IUPAC name is sodium;2-butyl-6-methyl-3-[[4-[4-(2H-tetrazol-5-yl)thiophen-3-yl]phenyl]methyl]quinazolin-4-one;dihydrogen phosphate.
| Compound Name | sodium;2-butyl-6-methyl-3-[[4-[4-(2H-tetrazol-5-yl)thiophen-3-yl]phenyl]methyl]quinazolin-4-one;dihydrogen phosphate |
|---|---|
| PubChem CID | 23716304 |
| Molecular Formula | C25H26N6NaO5PS |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | sodium;2-butyl-6-methyl-3-[[4-[4-(2H-tetrazol-5-yl)thiophen-3-yl]phenyl]methyl]quinazolin-4-one;dihydrogen phosphate |
| SMILES | CCCCc1nc2ccc(C)cc2c(=O)n1Cc1ccc(-c2cscc2-c2nn[nH]n2)cc1.O=P([O-])(O)O.[Na+] |
| InChI | InChI=1S/C25H24N6OS.Na.H3O4P/c1-3-4-5-23-26-22-11-6-16(2)12-19(22)25(32)31(23)13-17-7-9-18(10-8-17)20-14-33-15-21(20)24-27-29-30-28-24;;1-5(2,3)4/h6-12,14-15H,3-5,13H2,1-2H3,(H,27,28,29,30);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | XSYQVRYUWFQEPK-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|