About lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate
lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate (PubChem CID 23716349) has the molecular formula C9H16LiNO4S
and a molecular weight of 241.24 g/mol. Its IUPAC name is lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate.
Molecular Properties
| Compound Name | lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate |
| PubChem CID | 23716349 |
| Molecular Formula | C9H16LiNO4S |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate |
| SMILES | C1COCCOCCOCCO1.N#C[S-].[Li+] |
| InChI | InChI=1S/C8H16O4.CHNS.Li/c1-2-10-5-6-12-8-7-11-4-3-9-1;2-1-3;/h1-8H2;3H;/q;;+1/p-1 |
| InChIKey | FSAJVTCYIZDJBA-UHFFFAOYSA-M |
| XLogP | -2.92 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate?
The IUPAC name of lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate (CID 23716349) is lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate.
What is the SMILES notation for lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate?
The canonical SMILES for lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate is C1COCCOCCOCCO1.N#C[S-].[Li+].
What is the InChIKey of lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate?
The InChIKey is FSAJVTCYIZDJBA-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O4.CHNS.Li/c1-2-10-5-6-12-8-7-11-4-3-9-1;2-1-3;/h1-8H2;3H;/q;;+1/p-1.
What are the key properties of lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate?
lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate has a molecular weight of 241.24 g/mol, XLogP of -2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,4,7,10-tetraoxacyclododecane;thiocyanate is sourced from PubChem (CID 23716349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).