potassium (carboxymethylamino)methyl-hydroxyphosphinate

C3H7KNO5P — CID 23716553

IUPACpotassium (carboxymethylamino)methyl-hydroxyphosphinate
SMILESO=C(O)CNCP(=O)([O-])O.[K+]
InChIInChI=1S/C3H8NO5P.K/c5-3(6)1-4-2-10(7,8)9;/h4H,1-2H2,(H,5,6)(H2,7,8,9);/q;+1/p-1
InChIKeyLIOPHZNMBKHGAV-UHFFFAOYSA-M
MW207.16 g/mol
LogP-4.83
Rot. Bonds4

About potassium (carboxymethylamino)methyl-hydroxyphosphinate

potassium (carboxymethylamino)methyl-hydroxyphosphinate (PubChem CID 23716553) has the molecular formula C3H7KNO5P and a molecular weight of 207.16 g/mol. Its IUPAC name is potassium (carboxymethylamino)methyl-hydroxyphosphinate.

Molecular Properties

Compound Namepotassium (carboxymethylamino)methyl-hydroxyphosphinate
PubChem CID23716553
Molecular FormulaC3H7KNO5P
Molecular Weight207.16 g/mol
Exact Mass206.97
IUPAC Namepotassium (carboxymethylamino)methyl-hydroxyphosphinate
SMILESO=C(O)CNCP(=O)([O-])O.[K+]
InChIInChI=1S/C3H8NO5P.K/c5-3(6)1-4-2-10(7,8)9;/h4H,1-2H2,(H,5,6)(H2,7,8,9);/q;+1/p-1
InChIKeyLIOPHZNMBKHGAV-UHFFFAOYSA-M
XLogP-4.83
TPSA109.69 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.16
LogP ≤ 5-4.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze potassium (carboxymethylamino)methyl-hydroxyphosphinate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (carboxymethylamino)methyl-hydroxyphosphinate?
The IUPAC name of potassium (carboxymethylamino)methyl-hydroxyphosphinate (CID 23716553) is potassium (carboxymethylamino)methyl-hydroxyphosphinate.
What is the SMILES notation for potassium (carboxymethylamino)methyl-hydroxyphosphinate?
The canonical SMILES for potassium (carboxymethylamino)methyl-hydroxyphosphinate is O=C(O)CNCP(=O)([O-])O.[K+].
What is the InChIKey of potassium (carboxymethylamino)methyl-hydroxyphosphinate?
The InChIKey is LIOPHZNMBKHGAV-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8NO5P.K/c5-3(6)1-4-2-10(7,8)9;/h4H,1-2H2,(H,5,6)(H2,7,8,9);/q;+1/p-1.
What are the key properties of potassium (carboxymethylamino)methyl-hydroxyphosphinate?
potassium (carboxymethylamino)methyl-hydroxyphosphinate has a molecular weight of 207.16 g/mol, XLogP of -4.83, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (carboxymethylamino)methyl-hydroxyphosphinate is sourced from PubChem (CID 23716553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).