About (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate (PubChem CID 2371679) has the molecular formula C14H9ClN4O3
and a molecular weight of 316.70 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate |
| PubChem CID | 2371679 |
| Molecular Formula | C14H9ClN4O3 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)c1cccnc1Cl |
| InChI | InChI=1S/C14H9ClN4O3/c15-12-10(5-3-7-16-12)14(21)22-8-19-13(20)9-4-1-2-6-11(9)17-18-19/h1-7H,8H2 |
| InChIKey | FGQDIDPZWGTUNP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate?
The IUPAC name of (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate (CID 2371679) is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate.
What is the SMILES notation for (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate?
The canonical SMILES for (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate is O=C(OCn1nnc2ccccc2c1=O)c1cccnc1Cl.
What is the InChIKey of (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate?
The InChIKey is FGQDIDPZWGTUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN4O3/c15-12-10(5-3-7-16-12)14(21)22-8-19-13(20)9-4-1-2-6-11(9)17-18-19/h1-7H,8H2.
What are the key properties of (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate?
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate has a molecular weight of 316.70 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-chloropyridine-3-carboxylate is sourced from PubChem (CID 2371679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).