About (4-methylsulfanylphenyl) dipropyl phosphate
(4-methylsulfanylphenyl) dipropyl phosphate (PubChem CID 23717) has the molecular formula C13H21O4PS
and a molecular weight of 304.35 g/mol. Its IUPAC name is (4-methylsulfanylphenyl) dipropyl phosphate.
Molecular Properties
| Compound Name | (4-methylsulfanylphenyl) dipropyl phosphate |
| PubChem CID | 23717 |
| Molecular Formula | C13H21O4PS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (4-methylsulfanylphenyl) dipropyl phosphate |
| SMILES | CCCOP(=O)(OCCC)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C13H21O4PS/c1-4-10-15-18(14,16-11-5-2)17-12-6-8-13(19-3)9-7-12/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | PWYIUEFFPNVCMW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-methylsulfanylphenyl) dipropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylsulfanylphenyl) dipropyl phosphate?
The IUPAC name of (4-methylsulfanylphenyl) dipropyl phosphate (CID 23717) is (4-methylsulfanylphenyl) dipropyl phosphate.
What is the SMILES notation for (4-methylsulfanylphenyl) dipropyl phosphate?
The canonical SMILES for (4-methylsulfanylphenyl) dipropyl phosphate is CCCOP(=O)(OCCC)Oc1ccc(SC)cc1.
What is the InChIKey of (4-methylsulfanylphenyl) dipropyl phosphate?
The InChIKey is PWYIUEFFPNVCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21O4PS/c1-4-10-15-18(14,16-11-5-2)17-12-6-8-13(19-3)9-7-12/h6-9H,4-5,10-11H2,1-3H3.
What are the key properties of (4-methylsulfanylphenyl) dipropyl phosphate?
(4-methylsulfanylphenyl) dipropyl phosphate has a molecular weight of 304.35 g/mol, XLogP of 4.75, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylsulfanylphenyl) dipropyl phosphate is sourced from PubChem (CID 23717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).