About sodium prop-2-enyl carbonate
sodium prop-2-enyl carbonate (PubChem CID 23717119) has the molecular formula C4H5NaO3
and a molecular weight of 124.07 g/mol. Its IUPAC name is sodium prop-2-enyl carbonate.
Molecular Properties
| Compound Name | sodium prop-2-enyl carbonate |
| PubChem CID | 23717119 |
| Molecular Formula | C4H5NaO3 |
| Molecular Weight | 124.07 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | sodium prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H6O3.Na/c1-2-3-7-4(5)6;/h2H,1,3H2,(H,5,6);/q;+1/p-1 |
| InChIKey | KSZMOOVMIIQFHA-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.07 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium prop-2-enyl carbonate?
The IUPAC name of sodium prop-2-enyl carbonate (CID 23717119) is sodium prop-2-enyl carbonate.
What is the SMILES notation for sodium prop-2-enyl carbonate?
The canonical SMILES for sodium prop-2-enyl carbonate is C=CCOC(=O)[O-].[Na+].
What is the InChIKey of sodium prop-2-enyl carbonate?
The InChIKey is KSZMOOVMIIQFHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O3.Na/c1-2-3-7-4(5)6;/h2H,1,3H2,(H,5,6);/q;+1/p-1.
What are the key properties of sodium prop-2-enyl carbonate?
sodium prop-2-enyl carbonate has a molecular weight of 124.07 g/mol, XLogP of -3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium prop-2-enyl carbonate is sourced from PubChem (CID 23717119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).