C8H4F10KNO2 — CID 23717380
potassium 2-(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)propanoate (PubChem CID 23717380) has the molecular formula C8H4F10KNO2 and a molecular weight of 375.20 g/mol. Its IUPAC name is potassium 2-(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)propanoate.
| Compound Name | potassium 2-(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)propanoate |
|---|---|
| PubChem CID | 23717380 |
| Molecular Formula | C8H4F10KNO2 |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | potassium 2-(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)propanoate |
| SMILES | CC(C(=O)[O-])N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.[K+] |
| InChI | InChI=1S/C8H5F10NO2.K/c1-2(3(20)21)19-7(15,16)5(11,12)4(9,10)6(13,14)8(19,17)18;/h2H,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | WASBJVQJGJWBJJ-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|