C14H13N4NaO5 — CID 23718448
sodium;3,7-dimethylpurine-2,6-dione;2-hydroxybenzoate (PubChem CID 23718448) has the molecular formula C14H13N4NaO5 and a molecular weight of 340.27 g/mol. Its IUPAC name is sodium;3,7-dimethylpurine-2,6-dione;2-hydroxybenzoate.
| Compound Name | sodium;3,7-dimethylpurine-2,6-dione;2-hydroxybenzoate |
|---|---|
| PubChem CID | 23718448 |
| Molecular Formula | C14H13N4NaO5 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | sodium;3,7-dimethylpurine-2,6-dione;2-hydroxybenzoate |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C.O=C([O-])c1ccccc1O.[Na+] |
| InChI | InChI=1S/C7H8N4O2.C7H6O3.Na/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;8-6-4-2-1-3-5(6)7(9)10;/h3H,1-2H3,(H,9,12,13);1-4,8H,(H,9,10);/q;;+1/p-1 |
| InChIKey | WSRBRQQGWDWSON-UHFFFAOYSA-M |
| XLogP | -4.28 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |