About sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate
sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate (PubChem CID 23719495) has the molecular formula C14H9NaO8S
and a molecular weight of 360.28 g/mol. Its IUPAC name is sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate.
Molecular Properties
| Compound Name | sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate |
| PubChem CID | 23719495 |
| Molecular Formula | C14H9NaO8S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate |
| SMILES | O.O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)[O-])c(O)c2O.[Na+] |
| InChI | InChI=1S/C14H8O7S.Na.H2O/c15-11-6-3-1-2-4-7(6)12(16)10-8(11)5-9(22(19,20)21)13(17)14(10)18;;/h1-5,17-18H,(H,19,20,21);;1H2/q;+1;/p-1 |
| InChIKey | RXCPGWSCILFWCH-UHFFFAOYSA-M |
| XLogP | -3.04 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate?
The IUPAC name of sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate (CID 23719495) is sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate.
What is the SMILES notation for sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate?
The canonical SMILES for sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate is O.O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)[O-])c(O)c2O.[Na+].
What is the InChIKey of sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate?
The InChIKey is RXCPGWSCILFWCH-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H8O7S.Na.H2O/c15-11-6-3-1-2-4-7(6)12(16)10-8(11)5-9(22(19,20)21)13(17)14(10)18;;/h1-5,17-18H,(H,19,20,21);;1H2/q;+1;/p-1.
What are the key properties of sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate?
sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate has a molecular weight of 360.28 g/mol, XLogP of -3.04, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate;hydrate is sourced from PubChem (CID 23719495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).