About sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate
sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate (PubChem CID 23720354) has the molecular formula C5H5F3N3NaO3S
and a molecular weight of 267.16 g/mol. Its IUPAC name is sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate.
Molecular Properties
| Compound Name | sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate |
| PubChem CID | 23720354 |
| Molecular Formula | C5H5F3N3NaO3S |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate |
| SMILES | CCn1c(C(F)(F)F)nnc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H6F3N3O3S.Na/c1-2-11-3(5(6,7)8)9-10-4(11)15(12,13)14;/h2H2,1H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | PXMLSTJFCWIFQS-UHFFFAOYSA-M |
| XLogP | -2.78 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate?
The IUPAC name of sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate (CID 23720354) is sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate.
What is the SMILES notation for sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate?
The canonical SMILES for sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate is CCn1c(C(F)(F)F)nnc1S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate?
The InChIKey is PXMLSTJFCWIFQS-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6F3N3O3S.Na/c1-2-11-3(5(6,7)8)9-10-4(11)15(12,13)14;/h2H2,1H3,(H,12,13,14);/q;+1/p-1.
What are the key properties of sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate?
sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate has a molecular weight of 267.16 g/mol, XLogP of -2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonate is sourced from PubChem (CID 23720354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).