C6F11KO3S — CID 23720899
potassium (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) sulfite (PubChem CID 23720899) has the molecular formula C6F11KO3S and a molecular weight of 400.21 g/mol. Its IUPAC name is potassium (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) sulfite.
| Compound Name | potassium (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) sulfite |
|---|---|
| PubChem CID | 23720899 |
| Molecular Formula | C6F11KO3S |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 399.90 |
| IUPAC Name | potassium (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) sulfite |
| SMILES | O=S([O-])OC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.[K+] |
| InChI | InChI=1S/C6HF11O3S.K/c7-1(8)2(9,10)4(13,14)6(17,20-21(18)19)5(15,16)3(1,11)12;/h(H,18,19);/q;+1/p-1 |
| InChIKey | RVUYAFMKEGGKPG-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|