About sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione
sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione (PubChem CID 23721629) has the molecular formula C8H7NaO4
and a molecular weight of 190.13 g/mol. Its IUPAC name is sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione.
Molecular Properties
| Compound Name | sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione |
| PubChem CID | 23721629 |
| Molecular Formula | C8H7NaO4 |
| Molecular Weight | 190.13 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione |
| SMILES | CC(=O)[c-]1c(=O)cc(C)oc1=O.[Na+] |
| InChI | InChI=1S/C8H7O4.Na/c1-4-3-6(10)7(5(2)9)8(11)12-4;/h3H,1-2H3;/q-1;+1 |
| InChIKey | YIOCQGHBBNGBND-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.13 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione?
The IUPAC name of sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione (CID 23721629) is sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione.
What is the SMILES notation for sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione?
The canonical SMILES for sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione is CC(=O)[c-]1c(=O)cc(C)oc1=O.[Na+].
What is the InChIKey of sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione?
The InChIKey is YIOCQGHBBNGBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O4.Na/c1-4-3-6(10)7(5(2)9)8(11)12-4;/h3H,1-2H3;/q-1;+1.
What are the key properties of sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione?
sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione has a molecular weight of 190.13 g/mol, XLogP of -2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-acetyl-6-methylpyran-3-ide-2,4-dione is sourced from PubChem (CID 23721629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).