About lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate
lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate (PubChem CID 23721679) has the molecular formula C21H19FLiNO3
and a molecular weight of 359.33 g/mol. Its IUPAC name is lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate.
Molecular Properties
| Compound Name | lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate |
| PubChem CID | 23721679 |
| Molecular Formula | C21H19FLiNO3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate |
| SMILES | O=C([O-])CN1CCC2(C=C(c3ccc(F)cc3)c3ccccc3O2)CC1.[Li+] |
| InChI | InChI=1S/C21H20FNO3.Li/c22-16-7-5-15(6-8-16)18-13-21(26-19-4-2-1-3-17(18)19)9-11-23(12-10-21)14-20(24)25;/h1-8,13H,9-12,14H2,(H,24,25);/q;+1/p-1 |
| InChIKey | DEZYNMMQUNLNDZ-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate?
The IUPAC name of lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate (CID 23721679) is lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate.
What is the SMILES notation for lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate?
The canonical SMILES for lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate is O=C([O-])CN1CCC2(C=C(c3ccc(F)cc3)c3ccccc3O2)CC1.[Li+].
What is the InChIKey of lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate?
The InChIKey is DEZYNMMQUNLNDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H20FNO3.Li/c22-16-7-5-15(6-8-16)18-13-21(26-19-4-2-1-3-17(18)19)9-11-23(12-10-21)14-20(24)25;/h1-8,13H,9-12,14H2,(H,24,25);/q;+1/p-1.
What are the key properties of lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate?
lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate has a molecular weight of 359.33 g/mol, XLogP of -0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-[4-(4-fluorophenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetate is sourced from PubChem (CID 23721679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).