C30H46O4 — CID 23723035
(1S,2S,4S,6S,9S,14R,15S,18S)-9-hydroxy-6,10,10,14,15,21,21-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one (PubChem CID 23723035) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (1S,2S,4S,6S,9S,14R,15S,18S)-9-hydroxy-6,10,10,14,15,21,21-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one.
| Compound Name | (1S,2S,4S,6S,9S,14R,15S,18S)-9-hydroxy-6,10,10,14,15,21,21-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one |
|---|---|
| PubChem CID | 23723035 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (1S,2S,4S,6S,9S,14R,15S,18S)-9-hydroxy-6,10,10,14,15,21,21-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one |
| SMILES | CC1(C)CC[C@@]23CC[C@]4(C)[C@@](OC2=O)(C3C1)[C@H]1OC1C1[C@@]2(C)CC[C@H](O)C(C)(C)C2CC[C@]14C |
| InChI | InChI=1S/C30H46O4/c1-24(2)12-14-29-15-13-28(7)27(6)11-8-17-25(3,4)19(31)9-10-26(17,5)21(27)20-22(33-20)30(28,18(29)16-24)34-23(29)32/h17-22,31H,8-16H2,1-7H3/t17?,18?,19-,20?,21?,22-,26-,27+,28-,29-,30+/m0/s1 |
| InChIKey | WBMXMSJTGDKFQT-SPZFXNIFSA-N |
| XLogP | 5.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|