About (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid
(2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid (PubChem CID 23723085) has the molecular formula C31H36N2O4
and a molecular weight of 500.64 g/mol. Its IUPAC name is (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid |
| PubChem CID | 23723085 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid |
| SMILES | CCCCN(Cc1ccc(C(=O)N[C@H](C(=O)O)C(C)C)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O4/c1-4-5-20-33(30(35)27(24-12-8-6-9-13-24)25-14-10-7-11-15-25)21-23-16-18-26(19-17-23)29(34)32-28(22(2)3)31(36)37/h6-19,22,27-28H,4-5,20-21H2,1-3H3,(H,32,34)(H,36,37)/t28-/m0/s1 |
| InChIKey | GLYBKWIRMABSSB-NDEPHWFRSA-N |
| XLogP | 5.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid?
The IUPAC name of (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid (CID 23723085) is (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid is CCCCN(Cc1ccc(C(=O)N[C@H](C(=O)O)C(C)C)cc1)C(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid?
The InChIKey is GLYBKWIRMABSSB-NDEPHWFRSA-N. The full InChI is InChI=1S/C31H36N2O4/c1-4-5-20-33(30(35)27(24-12-8-6-9-13-24)25-14-10-7-11-15-25)21-23-16-18-26(19-17-23)29(34)32-28(22(2)3)31(36)37/h6-19,22,27-28H,4-5,20-21H2,1-3H3,(H,32,34)(H,36,37)/t28-/m0/s1.
What are the key properties of (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid?
(2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid has a molecular weight of 500.64 g/mol, XLogP of 5.49, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[4-[[butyl-(2,2-diphenylacetyl)amino]methyl]benzoyl]amino]-3-methylbutanoic acid is sourced from PubChem (CID 23723085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).