C25H31FN2O5S — CID 23723104
(Z)-but-2-enedioic acid;1-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;hydrate (PubChem CID 23723104) has the molecular formula C25H31FN2O5S and a molecular weight of 490.60 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;hydrate.
| Compound Name | (Z)-but-2-enedioic acid;1-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;hydrate |
|---|---|
| PubChem CID | 23723104 |
| Molecular Formula | C25H31FN2O5S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;hydrate |
| SMILES | CC(C)c1ccc2c(c1)C(N1CCNCC1)Cc1ccc(F)cc1S2.O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H25FN2S.C4H4O4.H2O/c1-14(2)15-4-6-20-18(11-15)19(24-9-7-23-8-10-24)12-16-3-5-17(22)13-21(16)25-20;5-3(6)1-2-4(7)8;/h3-6,11,13-14,19,23H,7-10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1-; |
| InChIKey | IAALPYWHQFAMDR-FJOGWHKWSA-N |
| XLogP | 3.49 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|