About 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride
4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride (PubChem CID 23723105) has the molecular formula C18H22ClN3O
and a molecular weight of 331.85 g/mol. Its IUPAC name is 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride |
| PubChem CID | 23723105 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride |
| SMILES | CN1CCN(C(=O)N(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C18H21N3O.ClH/c1-19-12-14-20(15-13-19)18(22)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11H,12-15H2,1H3;1H |
| InChIKey | BKOCNPIRNIOTGA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride?
The IUPAC name of 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride (CID 23723105) is 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride.
What is the SMILES notation for 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride?
The canonical SMILES for 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride is CN1CCN(C(=O)N(c2ccccc2)c2ccccc2)CC1.Cl.
What is the InChIKey of 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride?
The InChIKey is BKOCNPIRNIOTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O.ClH/c1-19-12-14-20(15-13-19)18(22)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11H,12-15H2,1H3;1H.
What are the key properties of 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride?
4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride has a molecular weight of 331.85 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N,N-diphenylpiperazine-1-carboxamide;hydrochloride is sourced from PubChem (CID 23723105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).