About 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride
2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride (PubChem CID 23723121) has the molecular formula C19H25ClN2
and a molecular weight of 316.88 g/mol. Its IUPAC name is 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 23723121 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride |
| SMILES | Cc1cccc(C)c1/C(=N/CCN(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C19H24N2.ClH/c1-15-9-8-10-16(2)18(15)19(20-13-14-21(3)4)17-11-6-5-7-12-17;/h5-12H,13-14H2,1-4H3;1H/b20-19+; |
| InChIKey | SYZVXYVWEXVXBQ-RZLHGTIFSA-N |
| XLogP | 4.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride (CID 23723121) is 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride is Cc1cccc(C)c1/C(=N/CCN(C)C)c1ccccc1.Cl.
What is the InChIKey of 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride?
The InChIKey is SYZVXYVWEXVXBQ-RZLHGTIFSA-N. The full InChI is InChI=1S/C19H24N2.ClH/c1-15-9-8-10-16(2)18(15)19(20-13-14-21(3)4)17-11-6-5-7-12-17;/h5-12H,13-14H2,1-4H3;1H/b20-19+;.
What are the key properties of 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride?
2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride has a molecular weight of 316.88 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2,6-dimethylphenyl)-phenylmethylidene]amino]-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 23723121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).