About (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride
(2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride (PubChem CID 23723170) has the molecular formula C14H22ClNO3
and a molecular weight of 287.79 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride.
Molecular Properties
| Compound Name | (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride |
| PubChem CID | 23723170 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride |
| SMILES | COc1ccc(OC)c(C(O)C2CCCCN2)c1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-17-10-6-7-13(18-2)11(9-10)14(16)12-5-3-4-8-15-12;/h6-7,9,12,14-16H,3-5,8H2,1-2H3;1H |
| InChIKey | XPZVRGRMADTOOY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride?
The IUPAC name of (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride (CID 23723170) is (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride.
What is the SMILES notation for (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride?
The canonical SMILES for (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride is COc1ccc(OC)c(C(O)C2CCCCN2)c1.Cl.
What is the InChIKey of (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride?
The InChIKey is XPZVRGRMADTOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3.ClH/c1-17-10-6-7-13(18-2)11(9-10)14(16)12-5-3-4-8-15-12;/h6-7,9,12,14-16H,3-5,8H2,1-2H3;1H.
What are the key properties of (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride?
(2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride has a molecular weight of 287.79 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethoxyphenyl)-piperidin-2-ylmethanol;hydrochloride is sourced from PubChem (CID 23723170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).