About N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride
N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride (PubChem CID 23723174) has the molecular formula C20H26ClN3O5
and a molecular weight of 423.90 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride |
| PubChem CID | 23723174 |
| Molecular Formula | C20H26ClN3O5 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NC1CCN(Cc2ccccc2)CC1.Cl.O |
| InChI | InChI=1S/C20H23N3O4.ClH.H2O/c1-27-19-8-7-17(23(25)26)13-18(19)20(24)21-16-9-11-22(12-10-16)14-15-5-3-2-4-6-15;;/h2-8,13,16H,9-12,14H2,1H3,(H,21,24);1H;1H2 |
| InChIKey | YESDZWHDKWHBLA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
The IUPAC name of N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride (CID 23723174) is N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride.
What is the SMILES notation for N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
The canonical SMILES for N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride is COc1ccc([N+](=O)[O-])cc1C(=O)NC1CCN(Cc2ccccc2)CC1.Cl.O.
What is the InChIKey of N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
The InChIKey is YESDZWHDKWHBLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O4.ClH.H2O/c1-27-19-8-7-17(23(25)26)13-18(19)20(24)21-16-9-11-22(12-10-16)14-15-5-3-2-4-6-15;;/h2-8,13,16H,9-12,14H2,1H3,(H,21,24);1H;1H2.
What are the key properties of N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride has a molecular weight of 423.90 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride is sourced from PubChem (CID 23723174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).