About 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride
2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride (PubChem CID 23723184) has the molecular formula C17H26ClNO4
and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride |
| PubChem CID | 23723184 |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride |
| SMILES | CCCOc1ccc(C(=O)OCCN2CCCCC2)c(O)c1.Cl |
| InChI | InChI=1S/C17H25NO4.ClH/c1-2-11-21-14-6-7-15(16(19)13-14)17(20)22-12-10-18-8-4-3-5-9-18;/h6-7,13,19H,2-5,8-12H2,1H3;1H |
| InChIKey | QCLBKXKLUDFRIO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride?
The IUPAC name of 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride (CID 23723184) is 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride.
What is the SMILES notation for 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride?
The canonical SMILES for 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride is CCCOc1ccc(C(=O)OCCN2CCCCC2)c(O)c1.Cl.
What is the InChIKey of 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride?
The InChIKey is QCLBKXKLUDFRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4.ClH/c1-2-11-21-14-6-7-15(16(19)13-14)17(20)22-12-10-18-8-4-3-5-9-18;/h6-7,13,19H,2-5,8-12H2,1H3;1H.
What are the key properties of 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride?
2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride has a molecular weight of 343.85 g/mol, XLogP of 3.25, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2-hydroxy-4-propoxybenzoate;hydrochloride is sourced from PubChem (CID 23723184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).