C19H28FN3O2 — CID 23723218
N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N'-methylbutanediamide (PubChem CID 23723218) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N'-methylbutanediamide.
| Compound Name | N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 23723218 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N'-methylbutanediamide |
| SMILES | CN(CC1CCCN(CCc2ccc(F)cc2)C1)C(=O)CCC(N)=O |
| InChI | InChI=1S/C19H28FN3O2/c1-22(19(25)9-8-18(21)24)13-16-3-2-11-23(14-16)12-10-15-4-6-17(20)7-5-15/h4-7,16H,2-3,8-14H2,1H3,(H2,21,24) |
| InChIKey | BUVRGNXNLPTRKE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |