C24H29FN2O — CID 23723306
[1-[(1-ethylindol-3-yl)methyl]-3-[(4-fluorophenyl)methyl]piperidin-3-yl]methanol (PubChem CID 23723306) has the molecular formula C24H29FN2O and a molecular weight of 380.51 g/mol. Its IUPAC name is [1-[(1-ethylindol-3-yl)methyl]-3-[(4-fluorophenyl)methyl]piperidin-3-yl]methanol.
| Compound Name | [1-[(1-ethylindol-3-yl)methyl]-3-[(4-fluorophenyl)methyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 23723306 |
| Molecular Formula | C24H29FN2O |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [1-[(1-ethylindol-3-yl)methyl]-3-[(4-fluorophenyl)methyl]piperidin-3-yl]methanol |
| SMILES | CCn1cc(CN2CCCC(CO)(Cc3ccc(F)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C24H29FN2O/c1-2-27-16-20(22-6-3-4-7-23(22)27)15-26-13-5-12-24(17-26,18-28)14-19-8-10-21(25)11-9-19/h3-4,6-11,16,28H,2,5,12-15,17-18H2,1H3 |
| InChIKey | BFWFUAFDOXUGHC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |