About [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol
[1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol (PubChem CID 23723464) has the molecular formula C23H30ClNO4
and a molecular weight of 419.95 g/mol. Its IUPAC name is [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol |
| PubChem CID | 23723464 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol |
| SMILES | COc1cc(Cl)c(CN2CCC(CO)(CCOc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C23H30ClNO4/c1-27-21-14-18(20(24)15-22(21)28-2)16-25-11-8-23(17-26,9-12-25)10-13-29-19-6-4-3-5-7-19/h3-7,14-15,26H,8-13,16-17H2,1-2H3 |
| InChIKey | VHZBFOWZTRCNFA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
The IUPAC name of [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol (CID 23723464) is [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
The canonical SMILES for [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol is COc1cc(Cl)c(CN2CCC(CO)(CCOc3ccccc3)CC2)cc1OC.
What is the InChIKey of [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
The InChIKey is VHZBFOWZTRCNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30ClNO4/c1-27-21-14-18(20(24)15-22(21)28-2)16-25-11-8-23(17-26,9-12-25)10-13-29-19-6-4-3-5-7-19/h3-7,14-15,26H,8-13,16-17H2,1-2H3.
What are the key properties of [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
[1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol has a molecular weight of 419.95 g/mol, XLogP of 4.40, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-(2-phenoxyethyl)piperidin-4-yl]methanol is sourced from PubChem (CID 23723464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).