C18H20FN3O — CID 23723494
N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]pent-4-enamide (PubChem CID 23723494) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]pent-4-enamide.
| Compound Name | N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]pent-4-enamide |
|---|---|
| PubChem CID | 23723494 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC1CCCc2c1cnn2-c1ccccc1F |
| InChI | InChI=1S/C18H20FN3O/c1-2-3-11-18(23)21-15-8-6-10-16-13(15)12-20-22(16)17-9-5-4-7-14(17)19/h2,4-5,7,9,12,15H,1,3,6,8,10-11H2,(H,21,23) |
| InChIKey | URDKQIYPCLUFBT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|