About 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine
1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine (PubChem CID 23723503) has the molecular formula C23H29F2N3O
and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine.
Molecular Properties
| Compound Name | 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine |
| PubChem CID | 23723503 |
| Molecular Formula | C23H29F2N3O |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(C2CCCN(Cc3cc(F)cc(F)c3)C2)CC1 |
| InChI | InChI=1S/C23H29F2N3O/c1-29-23-7-3-2-6-22(23)28-11-9-27(10-12-28)21-5-4-8-26(17-21)16-18-13-19(24)15-20(25)14-18/h2-3,6-7,13-15,21H,4-5,8-12,16-17H2,1H3 |
| InChIKey | UNWXPWPWYIOSRQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine?
The IUPAC name of 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine (CID 23723503) is 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine.
What is the SMILES notation for 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine?
The canonical SMILES for 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine is COc1ccccc1N1CCN(C2CCCN(Cc3cc(F)cc(F)c3)C2)CC1.
What is the InChIKey of 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine?
The InChIKey is UNWXPWPWYIOSRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29F2N3O/c1-29-23-7-3-2-6-22(23)28-11-9-27(10-12-28)21-5-4-8-26(17-21)16-18-13-19(24)15-20(25)14-18/h2-3,6-7,13-15,21H,4-5,8-12,16-17H2,1H3.
What are the key properties of 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine?
1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine has a molecular weight of 401.50 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,5-difluorophenyl)methyl]piperidin-3-yl]-4-(2-methoxyphenyl)piperazine is sourced from PubChem (CID 23723503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).