C25H32N2O3 — CID 23723514
2-[4-[(6-methoxy-2H-chromen-3-yl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 23723514) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-[4-[(6-methoxy-2H-chromen-3-yl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(6-methoxy-2H-chromen-3-yl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 23723514 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-[4-[(6-methoxy-2H-chromen-3-yl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | COc1ccc2c(c1)C=C(CN1CCN(Cc3ccccc3C)C(CCO)C1)CO2 |
| InChI | InChI=1S/C25H32N2O3/c1-19-5-3-4-6-21(19)16-27-11-10-26(17-23(27)9-12-28)15-20-13-22-14-24(29-2)7-8-25(22)30-18-20/h3-8,13-14,23,28H,9-12,15-18H2,1-2H3 |
| InChIKey | VOZDFMKRDAILGC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |