C22H25FN2O3 — CID 23723538
methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylcarbamoyl]benzoate (PubChem CID 23723538) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 23723538 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl 4-[[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-methylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N(C)C2CCCN(Cc3ccccc3F)C2)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c1-24(21(26)16-9-11-17(12-10-16)22(27)28-2)19-7-5-13-25(15-19)14-18-6-3-4-8-20(18)23/h3-4,6,8-12,19H,5,7,13-15H2,1-2H3 |
| InChIKey | PKUFDQQSAMGBMR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |