C20H25N3O — CID 23723540
N-[6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]but-3-enamide (PubChem CID 23723540) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]but-3-enamide.
| Compound Name | N-[6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]but-3-enamide |
|---|---|
| PubChem CID | 23723540 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]but-3-enamide |
| SMILES | C=CCC(=O)NC1CC(C)(C)Cc2c1cnn2-c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-5-6-19(24)22-17-11-20(3,4)12-18-16(17)13-21-23(18)15-9-7-14(2)8-10-15/h5,7-10,13,17H,1,6,11-12H2,2-4H3,(H,22,24) |
| InChIKey | YTPLZQALSQUYTR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|