C21H27N3O2 — CID 23723549
N-[1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]pent-4-enamide (PubChem CID 23723549) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]pent-4-enamide.
| Compound Name | N-[1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]pent-4-enamide |
|---|---|
| PubChem CID | 23723549 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC1CC(C)(C)Cc2c1cnn2-c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-6-7-20(25)23-18-12-21(2,3)13-19-17(18)14-22-24(19)15-8-10-16(26-4)11-9-15/h5,8-11,14,18H,1,6-7,12-13H2,2-4H3,(H,23,25) |
| InChIKey | BWSAJMIPUSODEU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|