C24H29N3O — CID 23723566
N-[4-[(1-tert-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]phenyl]acetamide (PubChem CID 23723566) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[4-[(1-tert-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(1-tert-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23723566 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[4-[(1-tert-butyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCc3c([nH]c4ccccc34)C2C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-16(28)25-18-11-9-17(10-12-18)15-27-14-13-20-19-7-5-6-8-21(19)26-22(20)23(27)24(2,3)4/h5-12,23,26H,13-15H2,1-4H3,(H,25,28) |
| InChIKey | ZXRXZGRSZBBFGN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|