About (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone
(7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone (PubChem CID 23723572) has the molecular formula C22H22ClNO3
and a molecular weight of 383.88 g/mol. Its IUPAC name is (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone |
| PubChem CID | 23723572 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(Cl)c2oc(C(=O)N3CCC(O)(c4ccccc4)CC3)c(C)c2c1 |
| InChI | InChI=1S/C22H22ClNO3/c1-14-12-17-15(2)19(27-20(17)18(23)13-14)21(25)24-10-8-22(26,9-11-24)16-6-4-3-5-7-16/h3-7,12-13,26H,8-11H2,1-2H3 |
| InChIKey | HPGTZOYRBXTCJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
The IUPAC name of (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone (CID 23723572) is (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone.
What is the SMILES notation for (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
The canonical SMILES for (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone is Cc1cc(Cl)c2oc(C(=O)N3CCC(O)(c4ccccc4)CC3)c(C)c2c1.
What is the InChIKey of (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
The InChIKey is HPGTZOYRBXTCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClNO3/c1-14-12-17-15(2)19(27-20(17)18(23)13-14)21(25)24-10-8-22(26,9-11-24)16-6-4-3-5-7-16/h3-7,12-13,26H,8-11H2,1-2H3.
What are the key properties of (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
(7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone has a molecular weight of 383.88 g/mol, XLogP of 4.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-3,5-dimethyl-1-benzofuran-2-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone is sourced from PubChem (CID 23723572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).