C20H30N2O — CID 23723601
2-[1-(2,2-dimethylpropyl)-4-(3-phenylprop-2-ynyl)piperazin-2-yl]ethanol (PubChem CID 23723601) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropyl)-4-(3-phenylprop-2-ynyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[1-(2,2-dimethylpropyl)-4-(3-phenylprop-2-ynyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 23723601 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-[1-(2,2-dimethylpropyl)-4-(3-phenylprop-2-ynyl)piperazin-2-yl]ethanol |
| SMILES | CC(C)(C)CN1CCN(CC#Cc2ccccc2)CC1CCO |
| InChI | InChI=1S/C20H30N2O/c1-20(2,3)17-22-14-13-21(16-19(22)11-15-23)12-7-10-18-8-5-4-6-9-18/h4-6,8-9,19,23H,11-17H2,1-3H3 |
| InChIKey | DLJPAIPAHXZAGR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|