About 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol
2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 23723610) has the molecular formula C17H24F2N2O
and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol |
| PubChem CID | 23723610 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(C2CCC2)CCN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H24F2N2O/c18-16-5-4-13(10-17(16)19)11-20-7-8-21(14-2-1-3-14)12-15(20)6-9-22/h4-5,10,14-15,22H,1-3,6-9,11-12H2 |
| InChIKey | ZINUKPVQTFCKFA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol?
The IUPAC name of 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol (CID 23723610) is 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol.
What is the SMILES notation for 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol?
The canonical SMILES for 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol is OCCC1CN(C2CCC2)CCN1Cc1ccc(F)c(F)c1.
What is the InChIKey of 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol?
The InChIKey is ZINUKPVQTFCKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N2O/c18-16-5-4-13(10-17(16)19)11-20-7-8-21(14-2-1-3-14)12-15(20)6-9-22/h4-5,10,14-15,22H,1-3,6-9,11-12H2.
What are the key properties of 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol?
2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol has a molecular weight of 310.39 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-cyclobutyl-1-[(3,4-difluorophenyl)methyl]piperazin-2-yl]ethanol is sourced from PubChem (CID 23723610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).