About methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate
methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate (PubChem CID 23723663) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate.
Molecular Properties
| Compound Name | methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate |
| PubChem CID | 23723663 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc2oc(CCCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-21(25)11-6-14-23-22(26)17-12-13-19-18(15-17)24-20(28-19)10-5-9-16-7-3-2-4-8-16/h2-4,7-8,12-13,15H,5-6,9-11,14H2,1H3,(H,23,26) |
| InChIKey | VXAVWRVJDLJFLR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate?
The IUPAC name of methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate (CID 23723663) is methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate.
What is the SMILES notation for methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate?
The canonical SMILES for methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate is COC(=O)CCCNC(=O)c1ccc2oc(CCCc3ccccc3)nc2c1.
What is the InChIKey of methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate?
The InChIKey is VXAVWRVJDLJFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-27-21(25)11-6-14-23-22(26)17-12-13-19-18(15-17)24-20(28-19)10-5-9-16-7-3-2-4-8-16/h2-4,7-8,12-13,15H,5-6,9-11,14H2,1H3,(H,23,26).
What are the key properties of methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate?
methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate has a molecular weight of 380.44 g/mol, XLogP of 3.69, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(3-phenylpropyl)-1,3-benzoxazole-5-carbonyl]amino]butanoate is sourced from PubChem (CID 23723663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).