C19H25N3O3 — CID 2372376
N-benzyl-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-propan-2-ylacetamide (PubChem CID 2372376) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-propan-2-ylacetamide.
| Compound Name | N-benzyl-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 2372376 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-benzyl-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C19H25N3O3/c1-14(2)21(12-15-8-4-3-5-9-15)16(23)13-22-17(24)19(20-18(22)25)10-6-7-11-19/h3-5,8-9,14H,6-7,10-13H2,1-2H3,(H,20,25) |
| InChIKey | DWAXSYITLZTZLZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|